C19H34O3Si — CID 71734812
(2R,3R)-2-methyl-5-phenylmethoxy-3-triethylsilyloxypentan-1-ol (PubChem CID 71734812) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is (2R,3R)-2-methyl-5-phenylmethoxy-3-triethylsilyloxypentan-1-ol.
| Compound Name | (2R,3R)-2-methyl-5-phenylmethoxy-3-triethylsilyloxypentan-1-ol |
|---|---|
| PubChem CID | 71734812 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | (2R,3R)-2-methyl-5-phenylmethoxy-3-triethylsilyloxypentan-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@H](CCOCc1ccccc1)[C@H](C)CO |
| InChI | InChI=1S/C19H34O3Si/c1-5-23(6-2,7-3)22-19(17(4)15-20)13-14-21-16-18-11-9-8-10-12-18/h8-12,17,19-20H,5-7,13-16H2,1-4H3/t17-,19-/m1/s1 |
| InChIKey | KCSAJATVAXQHEZ-IEBWSBKVSA-N |
| XLogP | 4.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|