C24H42O2Si — CID 102122621
triethyl-[(E)-2-methyl-10-phenylmethoxydec-5-en-3-yl]oxysilane (PubChem CID 102122621) has the molecular formula C24H42O2Si and a molecular weight of 390.68 g/mol. Its IUPAC name is triethyl-[(E)-2-methyl-10-phenylmethoxydec-5-en-3-yl]oxysilane.
| Compound Name | triethyl-[(E)-2-methyl-10-phenylmethoxydec-5-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 102122621 |
| Molecular Formula | C24H42O2Si |
| Molecular Weight | 390.68 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | triethyl-[(E)-2-methyl-10-phenylmethoxydec-5-en-3-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)OC(C/C=C/CCCCOCc1ccccc1)C(C)C |
| InChI | InChI=1S/C24H42O2Si/c1-6-27(7-2,8-3)26-24(22(4)5)19-15-10-9-11-16-20-25-21-23-17-13-12-14-18-23/h10,12-15,17-18,22,24H,6-9,11,16,19-21H2,1-5H3/b15-10+ |
| InChIKey | LUQHBSPRRZZELA-XNTDXEJSSA-N |
| XLogP | 7.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.68 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|