C26H36O5 — CID 10982856
(E,4S,5S,7S)-5-methoxy-7-[(4-methoxyphenyl)methoxy]-4-methyl-9-phenylmethoxynon-2-en-1-ol (PubChem CID 10982856) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is (E,4S,5S,7S)-5-methoxy-7-[(4-methoxyphenyl)methoxy]-4-methyl-9-phenylmethoxynon-2-en-1-ol.
| Compound Name | (E,4S,5S,7S)-5-methoxy-7-[(4-methoxyphenyl)methoxy]-4-methyl-9-phenylmethoxynon-2-en-1-ol |
|---|---|
| PubChem CID | 10982856 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | (E,4S,5S,7S)-5-methoxy-7-[(4-methoxyphenyl)methoxy]-4-methyl-9-phenylmethoxynon-2-en-1-ol |
| SMILES | COc1ccc(CO[C@@H](CCOCc2ccccc2)C[C@H](OC)[C@@H](C)/C=C/CO)cc1 |
| InChI | InChI=1S/C26H36O5/c1-21(8-7-16-27)26(29-3)18-25(15-17-30-19-22-9-5-4-6-10-22)31-20-23-11-13-24(28-2)14-12-23/h4-14,21,25-27H,15-20H2,1-3H3/b8-7+/t21-,25-,26-/m0/s1 |
| InChIKey | YQSCGUDEOZWRGW-YMNBIVSOSA-N |
| XLogP | 4.78 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|