C27H34O7 — CID 11655773
6-[(2S,4S)-2-hydroxy-4-[(4-methoxyphenyl)methoxy]-6-phenylmethoxyhexyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 11655773) has the molecular formula C27H34O7 and a molecular weight of 470.56 g/mol. Its IUPAC name is 6-[(2S,4S)-2-hydroxy-4-[(4-methoxyphenyl)methoxy]-6-phenylmethoxyhexyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(2S,4S)-2-hydroxy-4-[(4-methoxyphenyl)methoxy]-6-phenylmethoxyhexyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 11655773 |
| Molecular Formula | C27H34O7 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 6-[(2S,4S)-2-hydroxy-4-[(4-methoxyphenyl)methoxy]-6-phenylmethoxyhexyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | COc1ccc(CO[C@@H](CCOCc2ccccc2)C[C@H](O)CC2=CC(=O)OC(C)(C)O2)cc1 |
| InChI | InChI=1S/C27H34O7/c1-27(2)33-25(17-26(29)34-27)16-22(28)15-24(13-14-31-18-20-7-5-4-6-8-20)32-19-21-9-11-23(30-3)12-10-21/h4-12,17,22,24,28H,13-16,18-19H2,1-3H3/t22-,24-/m0/s1 |
| InChIKey | JWAPMTYDNOOZKE-UPVQGACJSA-N |
| XLogP | 4.52 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|