C43H64O8Si — CID 51042320
(2R,4R,8R,10R)-12-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,10-bis[(4-methoxyphenyl)methoxy]-6-methylidene-1-phenylmethoxydodecan-4-ol (PubChem CID 51042320) has the molecular formula C43H64O8Si and a molecular weight of 737.06 g/mol. Its IUPAC name is (2R,4R,8R,10R)-12-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,10-bis[(4-methoxyphenyl)methoxy]-6-methylidene-1-phenylmethoxydodecan-4-ol.
| Compound Name | (2R,4R,8R,10R)-12-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,10-bis[(4-methoxyphenyl)methoxy]-6-methylidene-1-phenylmethoxydodecan-4-ol |
|---|---|
| PubChem CID | 51042320 |
| Molecular Formula | C43H64O8Si |
| Molecular Weight | 737.06 g/mol |
| Exact Mass | 736.44 |
| IUPAC Name | (2R,4R,8R,10R)-12-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,10-bis[(4-methoxyphenyl)methoxy]-6-methylidene-1-phenylmethoxydodecan-4-ol |
| SMILES | C=C(C[C@@H](O)C[C@H](COCc1ccccc1)OCc1ccc(OC)cc1)C[C@H](C[C@@H](CCO[Si](C)(C)C(C)(C)C)OCc1ccc(OC)cc1)OC |
| InChI | InChI=1S/C43H64O8Si/c1-33(25-37(44)27-42(32-48-29-34-13-11-10-12-14-34)50-31-36-17-21-39(46-6)22-18-36)26-41(47-7)28-40(23-24-51-52(8,9)43(2,3)4)49-30-35-15-19-38(45-5)20-16-35/h10-22,37,40-42,44H,1,23-32H2,2-9H3/t37-,40-,41-,42-/m1/s1 |
| InChIKey | GVGYDIOAWZDRPM-MSIQMXJESA-N |
| XLogP | 9.30 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.06 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|