C20H36O5Si — CID 46211134
(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methoxy]hexane-1,2-diol (PubChem CID 46211134) has the molecular formula C20H36O5Si and a molecular weight of 384.59 g/mol. Its IUPAC name is (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methoxy]hexane-1,2-diol.
| Compound Name | (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methoxy]hexane-1,2-diol |
|---|---|
| PubChem CID | 46211134 |
| Molecular Formula | C20H36O5Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methoxy]hexane-1,2-diol |
| SMILES | COc1ccc(COCC[C@H](C[C@@H](O)CO)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H36O5Si/c1-20(2,3)26(5,6)25-19(13-17(22)14-21)11-12-24-15-16-7-9-18(23-4)10-8-16/h7-10,17,19,21-22H,11-15H2,1-6H3/t17-,19-/m1/s1 |
| InChIKey | RRPHICSVVPRESZ-IEBWSBKVSA-N |
| XLogP | 3.74 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|