C45H82O7Si3 — CID 102445359
(3S,5R,7S,9S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-1,13-bis(phenylmethoxy)-3,11-bis(triethylsilyloxy)tridecane-5,7-diol (PubChem CID 102445359) has the molecular formula C45H82O7Si3 and a molecular weight of 819.40 g/mol. Its IUPAC name is (3S,5R,7S,9S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-1,13-bis(phenylmethoxy)-3,11-bis(triethylsilyloxy)tridecane-5,7-diol.
| Compound Name | (3S,5R,7S,9S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-1,13-bis(phenylmethoxy)-3,11-bis(triethylsilyloxy)tridecane-5,7-diol |
|---|---|
| PubChem CID | 102445359 |
| Molecular Formula | C45H82O7Si3 |
| Molecular Weight | 819.40 g/mol |
| Exact Mass | 818.54 |
| IUPAC Name | (3S,5R,7S,9S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-1,13-bis(phenylmethoxy)-3,11-bis(triethylsilyloxy)tridecane-5,7-diol |
| SMILES | CC[Si](CC)(CC)O[C@@H](CCOCc1ccccc1)C[C@H](O)C[C@H](O)C[C@@H](C[C@H](CCOCc1ccccc1)O[Si](CC)(CC)CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C45H82O7Si3/c1-12-54(13-2,14-3)51-42(28-30-48-36-38-24-20-18-21-25-38)33-40(46)32-41(47)34-44(50-53(10,11)45(7,8)9)35-43(52-55(15-4,16-5)17-6)29-31-49-37-39-26-22-19-23-27-39/h18-27,40-44,46-47H,12-17,28-37H2,1-11H3/t40-,41+,42+,43+,44+/m1/s1 |
| InChIKey | MYINILSPEJXWHE-NJDPJYPMSA-N |
| XLogP | 11.65 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.40 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|