C30H52O6Si — CID 23328324
[(3S,5R,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-formyloxy-1-phenylmethoxytetradecan-5-yl] acetate (PubChem CID 23328324) has the molecular formula C30H52O6Si and a molecular weight of 536.83 g/mol. Its IUPAC name is [(3S,5R,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-formyloxy-1-phenylmethoxytetradecan-5-yl] acetate.
| Compound Name | [(3S,5R,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-formyloxy-1-phenylmethoxytetradecan-5-yl] acetate |
|---|---|
| PubChem CID | 23328324 |
| Molecular Formula | C30H52O6Si |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 536.35 |
| IUPAC Name | [(3S,5R,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-formyloxy-1-phenylmethoxytetradecan-5-yl] acetate |
| SMILES | CCCCC[C@H](CCC[C@H](C[C@H](CCOCc1ccccc1)O[Si](C)(C)C(C)(C)C)OC(C)=O)OC=O |
| InChI | InChI=1S/C30H52O6Si/c1-8-9-11-17-27(34-24-31)18-14-19-28(35-25(2)32)22-29(36-37(6,7)30(3,4)5)20-21-33-23-26-15-12-10-13-16-26/h10,12-13,15-16,24,27-29H,8-9,11,14,17-23H2,1-7H3/t27-,28-,29+/m1/s1 |
| InChIKey | HSYZXYZDJXKJPS-NLDZOOGBSA-N |
| XLogP | 7.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|