C41H78O5Si3 — CID 44604460
[(3R,5S,7R,9R)-5,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]hexadec-1-en-3-yl] benzoate (PubChem CID 44604460) has the molecular formula C41H78O5Si3 and a molecular weight of 735.33 g/mol. Its IUPAC name is [(3R,5S,7R,9R)-5,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]hexadec-1-en-3-yl] benzoate.
| Compound Name | [(3R,5S,7R,9R)-5,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]hexadec-1-en-3-yl] benzoate |
|---|---|
| PubChem CID | 44604460 |
| Molecular Formula | C41H78O5Si3 |
| Molecular Weight | 735.33 g/mol |
| Exact Mass | 734.52 |
| IUPAC Name | [(3R,5S,7R,9R)-5,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]hexadec-1-en-3-yl] benzoate |
| SMILES | C=C[C@@H](C[C@@H](C[C@@H](C[C@@H](CCCCCCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C41H78O5Si3/c1-18-20-21-22-26-29-35(44-47(12,13)39(3,4)5)31-37(46-49(16,17)41(9,10)11)32-36(45-48(14,15)40(6,7)8)30-34(19-2)43-38(42)33-27-24-23-25-28-33/h19,23-25,27-28,34-37H,2,18,20-22,26,29-32H2,1,3-17H3/t34-,35+,36-,37+/m0/s1 |
| InChIKey | QCMYPMRSGOGVKH-TWHRXLCVSA-N |
| XLogP | 13.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.33 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|