C17H26O4Si — CID 11438668
[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxobutyl] benzoate (PubChem CID 11438668) has the molecular formula C17H26O4Si and a molecular weight of 322.48 g/mol. Its IUPAC name is [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxobutyl] benzoate.
| Compound Name | [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxobutyl] benzoate |
|---|---|
| PubChem CID | 11438668 |
| Molecular Formula | C17H26O4Si |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxobutyl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C=O)CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H26O4Si/c1-17(2,3)22(4,5)21-15(13-18)11-12-20-16(19)14-9-7-6-8-10-14/h6-10,13,15H,11-12H2,1-5H3/t15-/m0/s1 |
| InChIKey | YPPPZJJRTHXMME-HNNXBMFYSA-N |
| XLogP | 3.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|