C26H42O4Si — CID 11166757
2-[(2S,3S,6R)-6-[(E)-2-[tert-butyl(dimethyl)silyl]oxypent-3-enyl]-3-methyloxan-2-yl]ethyl benzoate (PubChem CID 11166757) has the molecular formula C26H42O4Si and a molecular weight of 446.70 g/mol. Its IUPAC name is 2-[(2S,3S,6R)-6-[(E)-2-[tert-butyl(dimethyl)silyl]oxypent-3-enyl]-3-methyloxan-2-yl]ethyl benzoate.
| Compound Name | 2-[(2S,3S,6R)-6-[(E)-2-[tert-butyl(dimethyl)silyl]oxypent-3-enyl]-3-methyloxan-2-yl]ethyl benzoate |
|---|---|
| PubChem CID | 11166757 |
| Molecular Formula | C26H42O4Si |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 2-[(2S,3S,6R)-6-[(E)-2-[tert-butyl(dimethyl)silyl]oxypent-3-enyl]-3-methyloxan-2-yl]ethyl benzoate |
| SMILES | C/C=C/C(C[C@H]1CC[C@H](C)[C@H](CCOC(=O)c2ccccc2)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H42O4Si/c1-8-12-23(30-31(6,7)26(3,4)5)19-22-16-15-20(2)24(29-22)17-18-28-25(27)21-13-10-9-11-14-21/h8-14,20,22-24H,15-19H2,1-7H3/b12-8+/t20-,22+,23?,24-/m0/s1 |
| InChIKey | QPLZLUHTDNBPFF-FYSASWRESA-N |
| XLogP | 6.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|