C22H44O3Si — CID 11292059
2-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]ethanol (PubChem CID 11292059) has the molecular formula C22H44O3Si and a molecular weight of 384.68 g/mol. Its IUPAC name is 2-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]ethanol.
| Compound Name | 2-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]ethanol |
|---|---|
| PubChem CID | 11292059 |
| Molecular Formula | C22H44O3Si |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | 2-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]ethanol |
| SMILES | CC(C)C/C=C/[C@@H](C[C@@H]1CC[C@H](C)[C@@H](CCO)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O3Si/c1-17(2)10-9-11-20(25-26(7,8)22(4,5)6)16-19-13-12-18(3)21(24-19)14-15-23/h9,11,17-21,23H,10,12-16H2,1-8H3/b11-9+/t18-,19-,20-,21+/m0/s1 |
| InChIKey | SNVAOXJPJYADOO-QEJORYRSSA-N |
| XLogP | 5.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|