C22H42O3Si — CID 16726244
(2R)-1-[(2S,5S,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxan-2-yl]-6-methylhept-3-yn-2-ol (PubChem CID 16726244) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is (2R)-1-[(2S,5S,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxan-2-yl]-6-methylhept-3-yn-2-ol.
| Compound Name | (2R)-1-[(2S,5S,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxan-2-yl]-6-methylhept-3-yn-2-ol |
|---|---|
| PubChem CID | 16726244 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (2R)-1-[(2S,5S,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyloxan-2-yl]-6-methylhept-3-yn-2-ol |
| SMILES | CC(C)CC#C[C@H](O)C[C@@H]1CC[C@H](C)[C@@H](CCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H42O3Si/c1-17(2)10-9-11-19(23)16-20-13-12-18(3)21(25-20)14-15-24-26(7,8)22(4,5)6/h17-21,23H,10,12-16H2,1-8H3/t18-,19-,20-,21+/m0/s1 |
| InChIKey | CHNGGTUBEORMLX-XSDIEEQYSA-N |
| XLogP | 5.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|