C23H44O3Si — CID 177390551
1-[(2R,3S,6S)-6-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]propan-2-one (PubChem CID 177390551) has the molecular formula C23H44O3Si and a molecular weight of 396.69 g/mol. Its IUPAC name is 1-[(2R,3S,6S)-6-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]propan-2-one.
| Compound Name | 1-[(2R,3S,6S)-6-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 177390551 |
| Molecular Formula | C23H44O3Si |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | 1-[(2R,3S,6S)-6-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1O[C@H](C[C@H](/C=C\CC(C)C)O[Si](C)(C)C(C)(C)C)CC[C@@H]1C |
| InChI | InChI=1S/C23H44O3Si/c1-17(2)11-10-12-21(26-27(8,9)23(5,6)7)16-20-14-13-18(3)22(25-20)15-19(4)24/h10,12,17-18,20-22H,11,13-16H2,1-9H3/b12-10-/t18-,20-,21-,22+/m0/s1 |
| InChIKey | BFSFBXSMXYJNOD-PRSRXGJWSA-N |
| XLogP | 6.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|