C20H40O5Si — CID 46894694
tert-butyl-[2-[(2R,3R,6S)-3-(2-methoxyethoxymethoxy)-6-prop-2-enyloxan-2-yl]ethoxy]-dimethylsilane (PubChem CID 46894694) has the molecular formula C20H40O5Si and a molecular weight of 388.62 g/mol. Its IUPAC name is tert-butyl-[2-[(2R,3R,6S)-3-(2-methoxyethoxymethoxy)-6-prop-2-enyloxan-2-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(2R,3R,6S)-3-(2-methoxyethoxymethoxy)-6-prop-2-enyloxan-2-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 46894694 |
| Molecular Formula | C20H40O5Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | tert-butyl-[2-[(2R,3R,6S)-3-(2-methoxyethoxymethoxy)-6-prop-2-enyloxan-2-yl]ethoxy]-dimethylsilane |
| SMILES | C=CC[C@@H]1CC[C@@H](OCOCCOC)[C@@H](CCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C20H40O5Si/c1-8-9-17-10-11-18(23-16-22-15-14-21-5)19(25-17)12-13-24-26(6,7)20(2,3)4/h8,17-19H,1,9-16H2,2-7H3/t17-,18-,19-/m1/s1 |
| InChIKey | JSOQVYPMLCMFDW-GUDVDZBRSA-N |
| XLogP | 4.53 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|