C18H38O5Si — CID 71492074
(3S,4R)-7-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-4-methylhept-1-en-4-ol (PubChem CID 71492074) has the molecular formula C18H38O5Si and a molecular weight of 362.58 g/mol. Its IUPAC name is (3S,4R)-7-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-4-methylhept-1-en-4-ol.
| Compound Name | (3S,4R)-7-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-4-methylhept-1-en-4-ol |
|---|---|
| PubChem CID | 71492074 |
| Molecular Formula | C18H38O5Si |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (3S,4R)-7-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-4-methylhept-1-en-4-ol |
| SMILES | C=C[C@H](OCOCCOC)[C@](C)(O)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O5Si/c1-9-16(22-15-21-14-13-20-6)18(5,19)11-10-12-23-24(7,8)17(2,3)4/h9,16,19H,1,10-15H2,2-8H3/t16-,18+/m0/s1 |
| InChIKey | DXODFIIZHWGXRJ-FUHWJXTLSA-N |
| XLogP | 3.73 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|