C31H51NO4Si — CID 10962478
(4S,5R)-N,N-dibenzyl-1-[tert-butyl(dimethyl)silyl]oxy-5-(2-methoxyethoxymethoxy)heptan-4-amine (PubChem CID 10962478) has the molecular formula C31H51NO4Si and a molecular weight of 529.84 g/mol. Its IUPAC name is (4S,5R)-N,N-dibenzyl-1-[tert-butyl(dimethyl)silyl]oxy-5-(2-methoxyethoxymethoxy)heptan-4-amine.
| Compound Name | (4S,5R)-N,N-dibenzyl-1-[tert-butyl(dimethyl)silyl]oxy-5-(2-methoxyethoxymethoxy)heptan-4-amine |
|---|---|
| PubChem CID | 10962478 |
| Molecular Formula | C31H51NO4Si |
| Molecular Weight | 529.84 g/mol |
| Exact Mass | 529.36 |
| IUPAC Name | (4S,5R)-N,N-dibenzyl-1-[tert-butyl(dimethyl)silyl]oxy-5-(2-methoxyethoxymethoxy)heptan-4-amine |
| SMILES | CC[C@@H](OCOCCOC)[C@H](CCCO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H51NO4Si/c1-8-30(35-26-34-23-22-33-5)29(20-15-21-36-37(6,7)31(2,3)4)32(24-27-16-11-9-12-17-27)25-28-18-13-10-14-19-28/h9-14,16-19,29-30H,8,15,20-26H2,1-7H3/t29-,30+/m0/s1 |
| InChIKey | DRDYONKAJLLUMT-XZWHSSHBSA-N |
| XLogP | 7.28 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.84 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|