C22H40O6Si — CID 10342557
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2-methoxyethoxymethoxymethyl)-3-phenylmethoxypropan-1-ol (PubChem CID 10342557) has the molecular formula C22H40O6Si and a molecular weight of 428.64 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2-methoxyethoxymethoxymethyl)-3-phenylmethoxypropan-1-ol.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2-methoxyethoxymethoxymethyl)-3-phenylmethoxypropan-1-ol |
|---|---|
| PubChem CID | 10342557 |
| Molecular Formula | C22H40O6Si |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2-methoxyethoxymethoxymethyl)-3-phenylmethoxypropan-1-ol |
| SMILES | COCCOCOCC(CO)(COCc1ccccc1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O6Si/c1-21(2,3)29(5,6)28-18-22(15-23,17-27-19-25-13-12-24-4)16-26-14-20-10-8-7-9-11-20/h7-11,23H,12-19H2,1-6H3 |
| InChIKey | BXYWIAGRBZTXSR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|