C19H33BrMgO3Si — CID 11144701
magnesium;tert-butyl-dimethyl-[(2R)-2-(phenylmethoxymethoxymethyl)butoxy]silane;bromide (PubChem CID 11144701) has the molecular formula C19H33BrMgO3Si and a molecular weight of 441.77 g/mol. Its IUPAC name is magnesium;tert-butyl-dimethyl-[(2R)-2-(phenylmethoxymethoxymethyl)butoxy]silane;bromide.
| Compound Name | magnesium;tert-butyl-dimethyl-[(2R)-2-(phenylmethoxymethoxymethyl)butoxy]silane;bromide |
|---|---|
| PubChem CID | 11144701 |
| Molecular Formula | C19H33BrMgO3Si |
| Molecular Weight | 441.77 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | magnesium;tert-butyl-dimethyl-[(2R)-2-(phenylmethoxymethoxymethyl)butoxy]silane;bromide |
| SMILES | [Br-].[CH2-]C[C@H](COCOCc1ccccc1)CO[Si](C)(C)C(C)(C)C.[Mg+2] |
| InChI | InChI=1S/C19H33O3Si.BrH.Mg/c1-7-17(15-22-23(5,6)19(2,3)4)13-20-16-21-14-18-11-9-8-10-12-18;;/h8-12,17H,1,7,13-16H2,2-6H3;1H;/q-1;;+2/p-1/t17-;;/m1../s1 |
| InChIKey | ATYIIQGXZBAVBW-ZEECNFPPSA-M |
| XLogP | 1.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.77 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|