C16H28OSi — CID 177106743
tert-butyl-[(2R,3S)-3-deuterio-2-methyl-3-phenylpropoxy]-dimethylsilane (PubChem CID 177106743) has the molecular formula C16H28OSi and a molecular weight of 265.49 g/mol. Its IUPAC name is tert-butyl-[(2R,3S)-3-deuterio-2-methyl-3-phenylpropoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S)-3-deuterio-2-methyl-3-phenylpropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 177106743 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 265.49 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | tert-butyl-[(2R,3S)-3-deuterio-2-methyl-3-phenylpropoxy]-dimethylsilane |
| SMILES | [2H][C@H](c1ccccc1)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28OSi/c1-14(12-15-10-8-7-9-11-15)13-17-18(5,6)16(2,3)4/h7-11,14H,12-13H2,1-6H3/t14-/m1/s1/i12D/t12-,14+/m0 |
| InChIKey | CBLKDBJJMDTGHT-WLLHCMBSSA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|