C29H40OPSi+ — CID 11410748
[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutyl]-triphenylphosphanium (PubChem CID 11410748) has the molecular formula C29H40OPSi+ and a molecular weight of 463.70 g/mol. Its IUPAC name is [(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutyl]-triphenylphosphanium.
| Compound Name | [(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 11410748 |
| Molecular Formula | C29H40OPSi+ |
| Molecular Weight | 463.70 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | [(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutyl]-triphenylphosphanium |
| SMILES | C[C@@H](CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H40OPSi/c1-25(24-30-32(5,6)29(2,3)4)22-23-31(26-16-10-7-11-17-26,27-18-12-8-13-19-27)28-20-14-9-15-21-28/h7-21,25H,22-24H2,1-6H3/q+1/t25-/m0/s1 |
| InChIKey | BSCMREQQEFICTA-VWLOTQADSA-N |
| XLogP | 7.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.70 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|