C33H46BrP — CID 10840468
triphenyl-[(3R,7R)-3,7,11-trimethyldodecyl]phosphanium bromide (PubChem CID 10840468) has the molecular formula C33H46BrP and a molecular weight of 553.61 g/mol. Its IUPAC name is triphenyl-[(3R,7R)-3,7,11-trimethyldodecyl]phosphanium bromide.
| Compound Name | triphenyl-[(3R,7R)-3,7,11-trimethyldodecyl]phosphanium bromide |
|---|---|
| PubChem CID | 10840468 |
| Molecular Formula | C33H46BrP |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | triphenyl-[(3R,7R)-3,7,11-trimethyldodecyl]phosphanium bromide |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C33H46P.BrH/c1-28(2)16-14-17-29(3)18-15-19-30(4)26-27-34(31-20-8-5-9-21-31,32-22-10-6-11-23-32)33-24-12-7-13-25-33;/h5-13,20-25,28-30H,14-19,26-27H2,1-4H3;1H/q+1;/p-1/t29-,30-;/m1./s1 |
| InChIKey | YHVCTQCOUAVUQV-GAQUOPITSA-M |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|