About triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate
triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate (PubChem CID 139080930) has the molecular formula C38H34I2O8P2
and a molecular weight of 934.44 g/mol. Its IUPAC name is triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate.
Molecular Properties
| Compound Name | triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate |
| PubChem CID | 139080930 |
| Molecular Formula | C38H34I2O8P2 |
| Molecular Weight | 934.44 g/mol |
| Exact Mass | 933.98 |
| IUPAC Name | triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate |
| SMILES | [O-][I+3]([O-])([O-])[O-].[O-][I+3]([O-])([O-])[O-].c1ccc([P+](CC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H34P2.2IO4/c1-7-19-33(20-8-1)39(34-21-9-2-10-22-34,35-23-11-3-12-24-35)31-32-40(36-25-13-4-14-26-36,37-27-15-5-16-28-37)38-29-17-6-18-30-38;2*2-1(3,4)5/h1-30H,31-32H2;;/q+2;2*-1 |
| InChIKey | XPOHOJZDUFTOTJ-UHFFFAOYSA-N |
| XLogP | -8.53 |
| TPSA | 184.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 934.44 |
| LogP ≤ 5 | -8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate?
The IUPAC name of triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate (CID 139080930) is triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate.
What is the SMILES notation for triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate?
The canonical SMILES for triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate is [O-][I+3]([O-])([O-])[O-].[O-][I+3]([O-])([O-])[O-].c1ccc([P+](CC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate?
The InChIKey is XPOHOJZDUFTOTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H34P2.2IO4/c1-7-19-33(20-8-1)39(34-21-9-2-10-22-34,35-23-11-3-12-24-35)31-32-40(36-25-13-4-14-26-36,37-27-15-5-16-28-37)38-29-17-6-18-30-38;2*2-1(3,4)5/h1-30H,31-32H2;;/q+2;2*-1.
What are the key properties of triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate?
triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate has a molecular weight of 934.44 g/mol, XLogP of -8.53, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for triphenyl(2-triphenylphosphaniumylethyl)phosphanium diperiodate is sourced from PubChem (CID 139080930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).