C23H26O2P+ — CID 10621039
3,3-dimethoxypropyl(triphenyl)phosphanium (PubChem CID 10621039) has the molecular formula C23H26O2P+ and a molecular weight of 365.43 g/mol. Its IUPAC name is 3,3-dimethoxypropyl(triphenyl)phosphanium.
| Compound Name | 3,3-dimethoxypropyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 10621039 |
| Molecular Formula | C23H26O2P+ |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 3,3-dimethoxypropyl(triphenyl)phosphanium |
| SMILES | COC(CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C23H26O2P/c1-24-23(25-2)18-19-26(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,23H,18-19H2,1-2H3/q+1 |
| InChIKey | HSWIADQNEDOVGD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|