C27H34O2P+ — CID 156628237
5,5-diethoxypentyl(triphenyl)phosphanium (PubChem CID 156628237) has the molecular formula C27H34O2P+ and a molecular weight of 421.54 g/mol. Its IUPAC name is 5,5-diethoxypentyl(triphenyl)phosphanium.
| Compound Name | 5,5-diethoxypentyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 156628237 |
| Molecular Formula | C27H34O2P+ |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 5,5-diethoxypentyl(triphenyl)phosphanium |
| SMILES | CCOC(CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)OCC |
| InChI | InChI=1S/C27H34O2P/c1-3-28-27(29-4-2)22-14-15-23-30(24-16-8-5-9-17-24,25-18-10-6-11-19-25)26-20-12-7-13-21-26/h5-13,16-21,27H,3-4,14-15,22-23H2,1-2H3/q+1 |
| InChIKey | DALXLNFSOISHDL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|