C37H52O2P+ — CID 175312604
[(E)-11,11-dibutoxyundec-4-enyl]-triphenylphosphanium (PubChem CID 175312604) has the molecular formula C37H52O2P+ and a molecular weight of 559.80 g/mol. Its IUPAC name is [(E)-11,11-dibutoxyundec-4-enyl]-triphenylphosphanium.
| Compound Name | [(E)-11,11-dibutoxyundec-4-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 175312604 |
| Molecular Formula | C37H52O2P+ |
| Molecular Weight | 559.80 g/mol |
| Exact Mass | 559.37 |
| IUPAC Name | [(E)-11,11-dibutoxyundec-4-enyl]-triphenylphosphanium |
| SMILES | CCCCOC(CCCCC/C=C/CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)OCCCC |
| InChI | InChI=1S/C37H52O2P/c1-3-5-31-38-37(39-32-6-4-2)30-22-11-9-7-8-10-12-23-33-40(34-24-16-13-17-25-34,35-26-18-14-19-27-35)36-28-20-15-21-29-36/h8,10,13-21,24-29,37H,3-7,9,11-12,22-23,30-33H2,1-2H3/q+1/b10-8+ |
| InChIKey | ZIUOOOSWIIRYLA-CSKARUKUSA-N |
| XLogP | 9.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.80 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|