C33H44IP — CID 10698794
[(E)-pentadec-4-enyl]-triphenylphosphanium iodide (PubChem CID 10698794) has the molecular formula C33H44IP and a molecular weight of 598.59 g/mol. Its IUPAC name is [(E)-pentadec-4-enyl]-triphenylphosphanium iodide.
| Compound Name | [(E)-pentadec-4-enyl]-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 10698794 |
| Molecular Formula | C33H44IP |
| Molecular Weight | 598.59 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | [(E)-pentadec-4-enyl]-triphenylphosphanium iodide |
| SMILES | CCCCCCCCCC/C=C/CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
| InChI | InChI=1S/C33H44P.HI/c1-2-3-4-5-6-7-8-9-10-11-12-13-23-30-34(31-24-17-14-18-25-31,32-26-19-15-20-27-32)33-28-21-16-22-29-33;/h11-12,14-22,24-29H,2-10,13,23,30H2,1H3;1H/q+1;/p-1/b12-11+; |
| InChIKey | GMPYEVFJHOZYLY-CALJPSDSSA-M |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|