C37H48P+ — CID 101375603
[(6E,12E)-nonadeca-6,12,18-trienyl]-triphenylphosphanium (PubChem CID 101375603) has the molecular formula C37H48P+ and a molecular weight of 523.77 g/mol. Its IUPAC name is [(6E,12E)-nonadeca-6,12,18-trienyl]-triphenylphosphanium.
| Compound Name | [(6E,12E)-nonadeca-6,12,18-trienyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 101375603 |
| Molecular Formula | C37H48P+ |
| Molecular Weight | 523.77 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | [(6E,12E)-nonadeca-6,12,18-trienyl]-triphenylphosphanium |
| SMILES | C=CCCCC/C=C/CCCC/C=C/CCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H48P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-27-34-38(35-28-21-18-22-29-35,36-30-23-19-24-31-36)37-32-25-20-26-33-37/h2,7-8,13-14,18-26,28-33H,1,3-6,9-12,15-17,27,34H2/q+1/b8-7+,14-13+ |
| InChIKey | CJQMEGIQTVVLQO-SCCLZRITSA-N |
| XLogP | 9.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.77 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|