C25H26IP — CID 10767189
[(3Z)-hepta-3,6-dienyl]-triphenylphosphanium iodide (PubChem CID 10767189) has the molecular formula C25H26IP and a molecular weight of 484.36 g/mol. Its IUPAC name is [(3Z)-hepta-3,6-dienyl]-triphenylphosphanium iodide.
| Compound Name | [(3Z)-hepta-3,6-dienyl]-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 10767189 |
| Molecular Formula | C25H26IP |
| Molecular Weight | 484.36 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | [(3Z)-hepta-3,6-dienyl]-triphenylphosphanium iodide |
| SMILES | C=CC/C=C\CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
| InChI | InChI=1S/C25H26P.HI/c1-2-3-4-5-15-22-26(23-16-9-6-10-17-23,24-18-11-7-12-19-24)25-20-13-8-14-21-25;/h2,4-14,16-21H,1,3,15,22H2;1H/q+1;/p-1/b5-4-; |
| InChIKey | ZGZMBXJAQIAOCI-MKWAYWHRSA-M |
| XLogP | 2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|