C26H30BrP — CID 22627871
oct-7-enyl(triphenyl)phosphanium bromide (PubChem CID 22627871) has the molecular formula C26H30BrP and a molecular weight of 453.40 g/mol. Its IUPAC name is oct-7-enyl(triphenyl)phosphanium bromide.
| Compound Name | oct-7-enyl(triphenyl)phosphanium bromide |
|---|---|
| PubChem CID | 22627871 |
| Molecular Formula | C26H30BrP |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | oct-7-enyl(triphenyl)phosphanium bromide |
| SMILES | C=CCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C26H30P.BrH/c1-2-3-4-5-6-16-23-27(24-17-10-7-11-18-24,25-19-12-8-13-20-25)26-21-14-9-15-22-26;/h2,7-15,17-22H,1,3-6,16,23H2;1H/q+1;/p-1 |
| InChIKey | AOLOSIOWOOLMCL-UHFFFAOYSA-M |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|