About nonyl(triphenyl)phosphanium;phosphane;bromide
nonyl(triphenyl)phosphanium;phosphane;bromide (PubChem CID 174988859) has the molecular formula C27H37BrP2
and a molecular weight of 503.45 g/mol. Its IUPAC name is nonyl(triphenyl)phosphanium;phosphane;bromide.
Molecular Properties
| Compound Name | nonyl(triphenyl)phosphanium;phosphane;bromide |
| PubChem CID | 174988859 |
| Molecular Formula | C27H37BrP2 |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | nonyl(triphenyl)phosphanium;phosphane;bromide |
| SMILES | CCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.P.[Br-] |
| InChI | InChI=1S/C27H34P.BrH.H3P/c1-2-3-4-5-6-7-17-24-28(25-18-11-8-12-19-25,26-20-13-9-14-21-26)27-22-15-10-16-23-27;;/h8-16,18-23H,2-7,17,24H2,1H3;1H;1H3/q+1;;/p-1 |
| InChIKey | UKYJPILWHQNLDK-UHFFFAOYSA-M |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze nonyl(triphenyl)phosphanium;phosphane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonyl(triphenyl)phosphanium;phosphane;bromide?
The IUPAC name of nonyl(triphenyl)phosphanium;phosphane;bromide (CID 174988859) is nonyl(triphenyl)phosphanium;phosphane;bromide.
What is the SMILES notation for nonyl(triphenyl)phosphanium;phosphane;bromide?
The canonical SMILES for nonyl(triphenyl)phosphanium;phosphane;bromide is CCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.P.[Br-].
What is the InChIKey of nonyl(triphenyl)phosphanium;phosphane;bromide?
The InChIKey is UKYJPILWHQNLDK-UHFFFAOYSA-M. The full InChI is InChI=1S/C27H34P.BrH.H3P/c1-2-3-4-5-6-7-17-24-28(25-18-11-8-12-19-25,26-20-13-9-14-21-26)27-22-15-10-16-23-27;;/h8-16,18-23H,2-7,17,24H2,1H3;1H;1H3/q+1;;/p-1.
What are the key properties of nonyl(triphenyl)phosphanium;phosphane;bromide?
nonyl(triphenyl)phosphanium;phosphane;bromide has a molecular weight of 503.45 g/mol, XLogP of 3.79, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for nonyl(triphenyl)phosphanium;phosphane;bromide is sourced from PubChem (CID 174988859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).