About nonyl(triphenyl)phosphanium;trichlorozinc(1-)
nonyl(triphenyl)phosphanium;trichlorozinc(1-) (PubChem CID 19420228) has the molecular formula C27H34Cl3PZn
and a molecular weight of 561.29 g/mol. Its IUPAC name is nonyl(triphenyl)phosphanium;trichlorozinc(1-).
Molecular Properties
| Compound Name | nonyl(triphenyl)phosphanium;trichlorozinc(1-) |
| PubChem CID | 19420228 |
| Molecular Formula | C27H34Cl3PZn |
| Molecular Weight | 561.29 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | nonyl(triphenyl)phosphanium;trichlorozinc(1-) |
| SMILES | CCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Cl[Zn-](Cl)Cl |
| InChI | InChI=1S/C27H34P.3ClH.Zn/c1-2-3-4-5-6-7-17-24-28(25-18-11-8-12-19-25,26-20-13-9-14-21-26)27-22-15-10-16-23-27;;;;/h8-16,18-23H,2-7,17,24H2,1H3;3*1H;/q+1;;;;+2/p-3 |
| InChIKey | WSCLMVBHRFYFSN-UHFFFAOYSA-K |
| XLogP | 8.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.29 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze nonyl(triphenyl)phosphanium;trichlorozinc(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonyl(triphenyl)phosphanium;trichlorozinc(1-)?
The IUPAC name of nonyl(triphenyl)phosphanium;trichlorozinc(1-) (CID 19420228) is nonyl(triphenyl)phosphanium;trichlorozinc(1-).
What is the SMILES notation for nonyl(triphenyl)phosphanium;trichlorozinc(1-)?
The canonical SMILES for nonyl(triphenyl)phosphanium;trichlorozinc(1-) is CCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Cl[Zn-](Cl)Cl.
What is the InChIKey of nonyl(triphenyl)phosphanium;trichlorozinc(1-)?
The InChIKey is WSCLMVBHRFYFSN-UHFFFAOYSA-K. The full InChI is InChI=1S/C27H34P.3ClH.Zn/c1-2-3-4-5-6-7-17-24-28(25-18-11-8-12-19-25,26-20-13-9-14-21-26)27-22-15-10-16-23-27;;;;/h8-16,18-23H,2-7,17,24H2,1H3;3*1H;/q+1;;;;+2/p-3.
What are the key properties of nonyl(triphenyl)phosphanium;trichlorozinc(1-)?
nonyl(triphenyl)phosphanium;trichlorozinc(1-) has a molecular weight of 561.29 g/mol, XLogP of 8.80, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for nonyl(triphenyl)phosphanium;trichlorozinc(1-) is sourced from PubChem (CID 19420228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).