C25H26P+ — CID 10767190
[(3Z)-hepta-3,6-dienyl]-triphenylphosphanium (PubChem CID 10767190) has the molecular formula C25H26P+ and a molecular weight of 357.46 g/mol. Its IUPAC name is [(3Z)-hepta-3,6-dienyl]-triphenylphosphanium.
| Compound Name | [(3Z)-hepta-3,6-dienyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 10767190 |
| Molecular Formula | C25H26P+ |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | [(3Z)-hepta-3,6-dienyl]-triphenylphosphanium |
| SMILES | C=CC/C=C\CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26P/c1-2-3-4-5-15-22-26(23-16-9-6-10-17-23,24-18-11-7-12-19-24)25-20-13-8-14-21-25/h2,4-14,16-21H,1,3,15,22H2/q+1/b5-4- |
| InChIKey | HAZGDVHVYVVNLF-PLNGDYQASA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|