C27H30P+ — CID 10099245
[(3Z,6Z)-nona-3,6-dienyl]-triphenylphosphanium (PubChem CID 10099245) has the molecular formula C27H30P+ and a molecular weight of 385.51 g/mol. Its IUPAC name is [(3Z,6Z)-nona-3,6-dienyl]-triphenylphosphanium.
| Compound Name | [(3Z,6Z)-nona-3,6-dienyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 10099245 |
| Molecular Formula | C27H30P+ |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | [(3Z,6Z)-nona-3,6-dienyl]-triphenylphosphanium |
| SMILES | CC/C=C\C/C=C\CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30P/c1-2-3-4-5-6-7-17-24-28(25-18-11-8-12-19-25,26-20-13-9-14-21-26)27-22-15-10-16-23-27/h3-4,6-16,18-23H,2,5,17,24H2,1H3/q+1/b4-3-,7-6- |
| InChIKey | SKENQZSQJLWFGR-CWWKMNTPSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|