C27H29BrP+ — CID 175818604
1-bromonona-3,6-dienyl(triphenyl)phosphanium (PubChem CID 175818604) has the molecular formula C27H29BrP+ and a molecular weight of 464.41 g/mol. Its IUPAC name is 1-bromonona-3,6-dienyl(triphenyl)phosphanium.
| Compound Name | 1-bromonona-3,6-dienyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 175818604 |
| Molecular Formula | C27H29BrP+ |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 1-bromonona-3,6-dienyl(triphenyl)phosphanium |
| SMILES | CCC=CCC=CCC(Br)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29BrP/c1-2-3-4-5-6-16-23-27(28)29(24-17-10-7-11-18-24,25-19-12-8-13-20-25)26-21-14-9-15-22-26/h3-4,6-22,27H,2,5,23H2,1H3/q+1 |
| InChIKey | VLSULWJHQSJGOG-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|