About (Z)-1,1-dibromohex-3-ene
(Z)-1,1-dibromohex-3-ene (PubChem CID 175999382) has the molecular formula C6H10Br2
and a molecular weight of 241.95 g/mol. Its IUPAC name is (Z)-1,1-dibromohex-3-ene.
Molecular Properties
| Compound Name | (Z)-1,1-dibromohex-3-ene |
| PubChem CID | 175999382 |
| Molecular Formula | C6H10Br2 |
| Molecular Weight | 241.95 g/mol |
| Exact Mass | 239.91 |
| IUPAC Name | (Z)-1,1-dibromohex-3-ene |
| SMILES | CC/C=C\CC(Br)Br |
| InChI | InChI=1S/C6H10Br2/c1-2-3-4-5-6(7)8/h3-4,6H,2,5H2,1H3/b4-3- |
| InChIKey | VOLFYJOPFPCOJN-ARJAWSKDSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.95 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,1-dibromohex-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,1-dibromohex-3-ene?
The IUPAC name of (Z)-1,1-dibromohex-3-ene (CID 175999382) is (Z)-1,1-dibromohex-3-ene.
What is the SMILES notation for (Z)-1,1-dibromohex-3-ene?
The canonical SMILES for (Z)-1,1-dibromohex-3-ene is CC/C=C\CC(Br)Br.
What is the InChIKey of (Z)-1,1-dibromohex-3-ene?
The InChIKey is VOLFYJOPFPCOJN-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H10Br2/c1-2-3-4-5-6(7)8/h3-4,6H,2,5H2,1H3/b4-3-.
What are the key properties of (Z)-1,1-dibromohex-3-ene?
(Z)-1,1-dibromohex-3-ene has a molecular weight of 241.95 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,1-dibromohex-3-ene is sourced from PubChem (CID 175999382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).