C13H28 — CID 159586775
6-deuterio-6-methylhept-3-ene;2,2-dimethylpropane (PubChem CID 159586775) has the molecular formula C13H28 and a molecular weight of 185.37 g/mol. Its IUPAC name is 6-deuterio-6-methylhept-3-ene;2,2-dimethylpropane.
| Compound Name | 6-deuterio-6-methylhept-3-ene;2,2-dimethylpropane |
|---|---|
| PubChem CID | 159586775 |
| Molecular Formula | C13H28 |
| Molecular Weight | 185.37 g/mol |
| Exact Mass | 185.23 |
| IUPAC Name | 6-deuterio-6-methylhept-3-ene;2,2-dimethylpropane |
| SMILES | CC(C)(C)C.[2H]C(C)(C)CC=CCC |
| InChI | InChI=1S/C8H16.C5H12/c1-4-5-6-7-8(2)3;1-5(2,3)4/h5-6,8H,4,7H2,1-3H3;1-4H3/i8D; |
| InChIKey | MJSIGSRGRSFWCG-RKMPQLHESA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|