C10H17Br — CID 174047229
(3Z,7E)-5-bromodeca-3,7-diene (PubChem CID 174047229) has the molecular formula C10H17Br and a molecular weight of 217.15 g/mol. Its IUPAC name is (3Z,7E)-5-bromodeca-3,7-diene.
| Compound Name | (3Z,7E)-5-bromodeca-3,7-diene |
|---|---|
| PubChem CID | 174047229 |
| Molecular Formula | C10H17Br |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | (3Z,7E)-5-bromodeca-3,7-diene |
| SMILES | CC/C=C\C(Br)C/C=C/CC |
| InChI | InChI=1S/C10H17Br/c1-3-5-7-9-10(11)8-6-4-2/h5-8,10H,3-4,9H2,1-2H3/b7-5+,8-6- |
| InChIKey | VJELBWQAKFRERW-YMBWGVAGSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|