C30H36Si — CID 135057523
[(1E)-dodeca-1,11-dienyl]-triphenylsilane (PubChem CID 135057523) has the molecular formula C30H36Si and a molecular weight of 424.70 g/mol. Its IUPAC name is [(1E)-dodeca-1,11-dienyl]-triphenylsilane.
| Compound Name | [(1E)-dodeca-1,11-dienyl]-triphenylsilane |
|---|---|
| PubChem CID | 135057523 |
| Molecular Formula | C30H36Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | [(1E)-dodeca-1,11-dienyl]-triphenylsilane |
| SMILES | C=CCCCCCCCC/C=C/[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H36Si/c1-2-3-4-5-6-7-8-9-10-20-27-31(28-21-14-11-15-22-28,29-23-16-12-17-24-29)30-25-18-13-19-26-30/h2,11-27H,1,3-10H2/b27-20+ |
| InChIKey | MLLDOJSFKNIEIC-NHFJDJAPSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|