C24H24Si — CID 10903938
[(1E,4Z)-hexa-1,4-dienyl]-triphenylsilane (PubChem CID 10903938) has the molecular formula C24H24Si and a molecular weight of 340.54 g/mol. Its IUPAC name is [(1E,4Z)-hexa-1,4-dienyl]-triphenylsilane.
| Compound Name | [(1E,4Z)-hexa-1,4-dienyl]-triphenylsilane |
|---|---|
| PubChem CID | 10903938 |
| Molecular Formula | C24H24Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | [(1E,4Z)-hexa-1,4-dienyl]-triphenylsilane |
| SMILES | C/C=C\C/C=C/[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24Si/c1-2-3-4-14-21-25(22-15-8-5-9-16-22,23-17-10-6-11-18-23)24-19-12-7-13-20-24/h2-3,5-21H,4H2,1H3/b3-2-,21-14+ |
| InChIKey | PGGIKADCORADSR-SNTPNGRLSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|