C44H42Si2 — CID 59974310
[4-[diphenyl(prop-1-enyl)silyl]phenyl]-diphenyl-[2-(2,4,5-trimethylphenyl)ethenyl]silane (PubChem CID 59974310) has the molecular formula C44H42Si2 and a molecular weight of 626.99 g/mol. Its IUPAC name is [4-[diphenyl(prop-1-enyl)silyl]phenyl]-diphenyl-[2-(2,4,5-trimethylphenyl)ethenyl]silane.
| Compound Name | [4-[diphenyl(prop-1-enyl)silyl]phenyl]-diphenyl-[2-(2,4,5-trimethylphenyl)ethenyl]silane |
|---|---|
| PubChem CID | 59974310 |
| Molecular Formula | C44H42Si2 |
| Molecular Weight | 626.99 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | [4-[diphenyl(prop-1-enyl)silyl]phenyl]-diphenyl-[2-(2,4,5-trimethylphenyl)ethenyl]silane |
| SMILES | CC=C[Si](c1ccccc1)(c1ccccc1)c1ccc([Si](C=Cc2cc(C)c(C)cc2C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C44H42Si2/c1-5-31-45(39-18-10-6-11-19-39,40-20-12-7-13-21-40)43-26-28-44(29-27-43)46(41-22-14-8-15-23-41,42-24-16-9-17-25-42)32-30-38-34-36(3)35(2)33-37(38)4/h5-34H,1-4H3 |
| InChIKey | KLXVOAPQKNDJPS-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.99 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|