C27H30OSi — CID 14203416
cis-(1S,2R)-2-[(E)-3-triphenylsilylprop-2-enyl]cyclohexan-1-ol (PubChem CID 14203416) has the molecular formula C27H30OSi and a molecular weight of 398.62 g/mol. Its IUPAC name is cis-(1S,2R)-2-[(E)-3-triphenylsilylprop-2-enyl]cyclohexan-1-ol.
| Compound Name | cis-(1S,2R)-2-[(E)-3-triphenylsilylprop-2-enyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 14203416 |
| Molecular Formula | C27H30OSi |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | cis-(1S,2R)-2-[(E)-3-triphenylsilylprop-2-enyl]cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1C/C=C/[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30OSi/c28-27-21-11-10-13-23(27)14-12-22-29(24-15-4-1-5-16-24,25-17-6-2-7-18-25)26-19-8-3-9-20-26/h1-9,12,15-20,22-23,27-28H,10-11,13-14,21H2/b22-12+/t23-,27+/m1/s1 |
| InChIKey | ZJGKEHISMUIPFD-DCDLNCORSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|