C18H26OSi — CID 134968226
trans-(2R,3S)-2-phenyl-3-[(E)-3-trimethylsilylprop-2-enyl]cyclohexan-1-one (PubChem CID 134968226) has the molecular formula C18H26OSi and a molecular weight of 286.49 g/mol. Its IUPAC name is trans-(2R,3S)-2-phenyl-3-[(E)-3-trimethylsilylprop-2-enyl]cyclohexan-1-one.
| Compound Name | trans-(2R,3S)-2-phenyl-3-[(E)-3-trimethylsilylprop-2-enyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 134968226 |
| Molecular Formula | C18H26OSi |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | trans-(2R,3S)-2-phenyl-3-[(E)-3-trimethylsilylprop-2-enyl]cyclohexan-1-one |
| SMILES | C[Si](C)(C)/C=C/C[C@@H]1CCCC(=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H26OSi/c1-20(2,3)14-8-12-16-11-7-13-17(19)18(16)15-9-5-4-6-10-15/h4-6,8-10,14,16,18H,7,11-13H2,1-3H3/b14-8+/t16-,18-/m0/s1 |
| InChIKey | MHWYCKKOQAVAFF-BEMPRJQSSA-N |
| XLogP | 4.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|