C19H19FO — CID 164673399
trans-(2R,3S)-3-benzyl-2-(4-fluorophenyl)cyclohexan-1-one (PubChem CID 164673399) has the molecular formula C19H19FO and a molecular weight of 282.36 g/mol. Its IUPAC name is trans-(2R,3S)-3-benzyl-2-(4-fluorophenyl)cyclohexan-1-one.
| Compound Name | trans-(2R,3S)-3-benzyl-2-(4-fluorophenyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 164673399 |
| Molecular Formula | C19H19FO |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | trans-(2R,3S)-3-benzyl-2-(4-fluorophenyl)cyclohexan-1-one |
| SMILES | O=C1CCC[C@@H](Cc2ccccc2)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FO/c20-17-11-9-15(10-12-17)19-16(7-4-8-18(19)21)13-14-5-2-1-3-6-14/h1-3,5-6,9-12,16,19H,4,7-8,13H2/t16-,19-/m0/s1 |
| InChIKey | LQVBZZUDMBRKNB-LPHOPBHVSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |