C13H19NNa — CID 162338619
CID 162338619 (PubChem CID 162338619) has the molecular formula C13H19NNa and a molecular weight of 212.29 g/mol.
| Compound Name | CID 162338619 |
|---|---|
| PubChem CID | 162338619 |
| Molecular Formula | C13H19NNa |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | — |
| SMILES | NC1CCCCC1Cc1ccccc1.[Na] |
| InChI | InChI=1S/C13H19N.Na/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11;/h1-3,6-7,12-13H,4-5,8-10,14H2; |
| InChIKey | VUJABSYWHSHRQL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |