C19H30N2 — CID 131851979
cis-(1R,2S)-2-[(4-benzylpiperidin-1-yl)methyl]cyclohexan-1-amine (PubChem CID 131851979) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(4-benzylpiperidin-1-yl)methyl]cyclohexan-1-amine.
| Compound Name | cis-(1R,2S)-2-[(4-benzylpiperidin-1-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 131851979 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | cis-(1R,2S)-2-[(4-benzylpiperidin-1-yl)methyl]cyclohexan-1-amine |
| SMILES | N[C@@H]1CCCC[C@H]1CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H30N2/c20-19-9-5-4-8-18(19)15-21-12-10-17(11-13-21)14-16-6-2-1-3-7-16/h1-3,6-7,17-19H,4-5,8-15,20H2/t18-,19+/m0/s1 |
| InChIKey | NGFXEEYLKWXBCH-RBUKOAKNSA-N |
| XLogP | 3.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |