C23H37N — CID 142080658
4-benzyl-1-[[(1R)-4-ethylcyclooctyl]methyl]piperidine (PubChem CID 142080658) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is 4-benzyl-1-[[(1R)-4-ethylcyclooctyl]methyl]piperidine.
| Compound Name | 4-benzyl-1-[[(1R)-4-ethylcyclooctyl]methyl]piperidine |
|---|---|
| PubChem CID | 142080658 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | 4-benzyl-1-[[(1R)-4-ethylcyclooctyl]methyl]piperidine |
| SMILES | CCC1CCCC[C@@H](CN2CCC(Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C23H37N/c1-2-20-8-6-7-11-23(13-12-20)19-24-16-14-22(15-17-24)18-21-9-4-3-5-10-21/h3-5,9-10,20,22-23H,2,6-8,11-19H2,1H3/t20?,23-/m1/s1 |
| InChIKey | KPNPARATSSDQGF-GWQXNCQPSA-N |
| XLogP | 5.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |