C21H34FN — CID 142001258
1-(cyclohexylmethyl)-4-[(4-fluorophenyl)methyl]piperidine;ethane (PubChem CID 142001258) has the molecular formula C21H34FN and a molecular weight of 319.51 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-4-[(4-fluorophenyl)methyl]piperidine;ethane.
| Compound Name | 1-(cyclohexylmethyl)-4-[(4-fluorophenyl)methyl]piperidine;ethane |
|---|---|
| PubChem CID | 142001258 |
| Molecular Formula | C21H34FN |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 319.27 |
| IUPAC Name | 1-(cyclohexylmethyl)-4-[(4-fluorophenyl)methyl]piperidine;ethane |
| SMILES | CC.Fc1ccc(CC2CCN(CC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C19H28FN.C2H6/c20-19-8-6-16(7-9-19)14-17-10-12-21(13-11-17)15-18-4-2-1-3-5-18;1-2/h6-9,17-18H,1-5,10-15H2;1-2H3 |
| InChIKey | CEQOQJKSZOAPKQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |