C21H31FN2O2 — CID 51127399
N-[1-(cyclohexylmethyl)piperidin-4-yl]-2-(4-fluorophenoxy)propanamide (PubChem CID 51127399) has the molecular formula C21H31FN2O2 and a molecular weight of 362.49 g/mol. Its IUPAC name is N-[1-(cyclohexylmethyl)piperidin-4-yl]-2-(4-fluorophenoxy)propanamide.
| Compound Name | N-[1-(cyclohexylmethyl)piperidin-4-yl]-2-(4-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 51127399 |
| Molecular Formula | C21H31FN2O2 |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | N-[1-(cyclohexylmethyl)piperidin-4-yl]-2-(4-fluorophenoxy)propanamide |
| SMILES | CC(Oc1ccc(F)cc1)C(=O)NC1CCN(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C21H31FN2O2/c1-16(26-20-9-7-18(22)8-10-20)21(25)23-19-11-13-24(14-12-19)15-17-5-3-2-4-6-17/h7-10,16-17,19H,2-6,11-15H2,1H3,(H,23,25) |
| InChIKey | GCETYUBJPHPJHF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |