C19H26FNO4 — CID 8935817
[(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] (2S)-2-(4-fluorophenoxy)propanoate (PubChem CID 8935817) has the molecular formula C19H26FNO4 and a molecular weight of 351.42 g/mol. Its IUPAC name is [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] (2S)-2-(4-fluorophenoxy)propanoate.
| Compound Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] (2S)-2-(4-fluorophenoxy)propanoate |
|---|---|
| PubChem CID | 8935817 |
| Molecular Formula | C19H26FNO4 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] (2S)-2-(4-fluorophenoxy)propanoate |
| SMILES | C[C@H](Oc1ccc(F)cc1)C(=O)O[C@H](C)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C19H26FNO4/c1-13(18(22)21-16-7-5-3-4-6-8-16)25-19(23)14(2)24-17-11-9-15(20)10-12-17/h9-14,16H,3-8H2,1-2H3,(H,21,22)/t13-,14+/m1/s1 |
| InChIKey | ALELECUWARJMMJ-KGLIPLIRSA-N |
| XLogP | 3.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |